1-(2,6-Dimethoxybenzyl)-N-methyl-4-piperidinamine structure
|
Common Name | 1-(2,6-Dimethoxybenzyl)-N-methyl-4-piperidinamine | ||
|---|---|---|---|---|
| CAS Number | 397245-00-0 | Molecular Weight | 264.363 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 357.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H24N2O2 | Melting Point | >350 | |
| MSDS | N/A | Flash Point | 169.8±27.9 °C | |
| Name | 2-Aminoiophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.2±42.0 °C at 760 mmHg |
| Melting Point | >350 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.363 |
| Flash Point | 169.8±27.9 °C |
| Exact Mass | 264.183777 |
| PSA | 33.73000 |
| LogP | 1.31 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | GDSOHLHQWSFYJN-UHFFFAOYSA-N |
| SMILES | CNC1CCN(Cc2c(OC)cccc2OC)CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2,6-dimethoxybenzyl)-N-methylpiperidin-4-amine |
| 4-Piperidinamine, 1-[(2,6-dimethoxyphenyl)methyl]-N-methyl- |
| 2-aminoisophthalic acid |
| 1-(2,6-Dimethoxybenzyl)-N-methyl-4-piperidinamine |