4-[(4-TRIFLUOROMETHYL)PHENOXY]PHENOL structure
|
Common Name | 4-[(4-TRIFLUOROMETHYL)PHENOXY]PHENOL | ||
|---|---|---|---|---|
| CAS Number | 39634-42-9 | Molecular Weight | 254.20500 | |
| Density | 1.324g/cm3 | Boiling Point | 319.4ºC at 760mmHg | |
| Molecular Formula | C13H9F3O2 | Melting Point | 49-54ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 150.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[4-(Trifluoromethyl)phenoxy]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 319.4ºC at 760mmHg |
| Melting Point | 49-54ºC(lit.) |
| Molecular Formula | C13H9F3O2 |
| Molecular Weight | 254.20500 |
| Flash Point | 150.5ºC |
| Exact Mass | 254.05500 |
| PSA | 29.46000 |
| LogP | 4.20330 |
| Index of Refraction | 1.532 |
| InChIKey | FJFSSESWAFPCSU-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2909500000 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Laccase catalyzed covalent coupling of fluorophenols increases lignocellulose surface hydrophobicity.
Bioresour. Technol. 101(8) , 2793-9, (2010) This work presents for the first time the mechanistic evidence of a laccase-catalyzed method of covalently grafting hydrophobicity enhancing fluorophenols onto Fagus sylvatica veneers. Coupling of flu... |
|
|
Dose-response regressions for algal growth and similar continuous endpoints: calculation of effective concentrations.
Environ. Toxicol. Chem. 28(4) , 826-35, (2009) We derive equations for the effective concentration giving 10% inhibition (EC10) with 95% confidence limits for probit (log-normal), Weibull, and logistic dose-response models on the basis of experime... |
| EINECS 254-549-8 |
| p-(p-trifluoromethylphenoxy)phenol |
| 4-(4-(trifluoromethyl)phenoxy)phenol |
| MFCD00192527 |
| p-(4-(Trifluoromethyl)phenoxy)phenol |
| 4-(p-trifluoromethylphenoxy)-phenol |