Benzene,1,1'-sulfonylbis[3-nitro-4-(4-nitrophenoxy)- structure
|
Common Name | Benzene,1,1'-sulfonylbis[3-nitro-4-(4-nitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 3950-58-1 | Molecular Weight | 582.45300 | |
| Density | 1.589g/cm3 | Boiling Point | 723.3ºC at 760 mmHg | |
| Molecular Formula | C24H14N4O12S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.2ºC | |
| Name | 2-nitro-4-[3-nitro-4-(4-nitrophenoxy)phenyl]sulfonyl-1-(4-nitrophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.589g/cm3 |
|---|---|
| Boiling Point | 723.3ºC at 760 mmHg |
| Molecular Formula | C24H14N4O12S |
| Molecular Weight | 582.45300 |
| Flash Point | 391.2ºC |
| Exact Mass | 582.03300 |
| PSA | 244.26000 |
| LogP | 8.91040 |
| Index of Refraction | 1.672 |
| InChIKey | VSAVCOJRHGXMCL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc([N+](=O)[O-])cc4)c([N+](=O)[O-])c3)cc2[N+](=O)[O-])cc1 |
|
~%
Benzene,1,1'-su... CAS#:3950-58-1 |
| Literature: Hart,W.F.; McGreal,M.E. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 141 - 142 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Hydroxy(5-((3-(hydroxy(oxido)amino)-4-(4-(hydroxy(oxido)amino)phenoxy)phenyl)sulfonyl)-2-(4-(hydroxy(oxido)amino)phenoxy)phenyl)azane oxide |
| Bis-<3-nitro-4-(4-nitro-phenoxy)-phenyl>-sulfon |
| 3,3'-dinitro-4,4'-di(p-nitrophenoxy)diphenylsulfone |