Acetamide,2-bromo-N-(2-hydroxy-5-nitrophenyl)- structure
|
Common Name | Acetamide,2-bromo-N-(2-hydroxy-5-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 3947-58-8 | Molecular Weight | 275.05600 | |
| Density | 1.884g/cm3 | Boiling Point | 472.3ºC at 760mmHg | |
| Molecular Formula | C8H7BrN2O4 | Melting Point | 215-220ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 239.5ºC | |
| Name | 2-bromo-N-(2-hydroxy-5-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.884g/cm3 |
|---|---|
| Boiling Point | 472.3ºC at 760mmHg |
| Melting Point | 215-220ºC (dec.)(lit.) |
| Molecular Formula | C8H7BrN2O4 |
| Molecular Weight | 275.05600 |
| Flash Point | 239.5ºC |
| Exact Mass | 273.95900 |
| PSA | 95.15000 |
| LogP | 2.23000 |
| Index of Refraction | 1.704 |
| InChIKey | STWBNOBMOCQPLR-UHFFFAOYSA-N |
| SMILES | O=C(CBr)Nc1cc([N+](=O)[O-])ccc1O |
| Storage condition | -20°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2924299090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Bromoacetamido-4-nitrophenol |
| 2-bromo-2'-hydroxy-5'-nitroacetanilide |
| Acetanilide,2-bromo-2'-hydroxy-5'-nitro |
| 2-Bromoacetamide-4-nitrophenol |
| EINECS 223-539-5 |