1-Methoxy-2-nitro-4-(trifluoromethyl)benzene structure
|
Common Name | 1-Methoxy-2-nitro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 394-25-2 | Molecular Weight | 221.133 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 251.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO3 | Melting Point | 47-49ºC(lit.) | |
| MSDS | N/A | Flash Point | 106.1±27.3 °C | |
| Name | 4-Methoxy-3-nitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 251.8±40.0 °C at 760 mmHg |
| Melting Point | 47-49ºC(lit.) |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.133 |
| Flash Point | 106.1±27.3 °C |
| Exact Mass | 221.029984 |
| PSA | 55.05000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | MAAFHLOZHBKYTG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| Storage condition | -20°C |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 22-26-36/37/39-45-27 |
| RIDADR | UN 3261 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2909309090 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-methoxy-2-nitro-4-(trifluoromethyl)- |
| EINECS 206-891-4 |
| MFCD00007099 |
| 1-Methoxy-2-nitro-4-(trifluoromethyl)benzene |
| 4-Trifluoromethyl-2-nitroanisole |
| 4-Methoxy-3-Nitrobenzotrifluoride |
| Methyl 2-nitro-4-(trifluoromethyl)phenyl ether |