EATON'S REAGENT structure
|
Common Name | EATON'S REAGENT | ||
|---|---|---|---|---|
| CAS Number | 39394-84-8 | Molecular Weight | 238.05000 | |
| Density | 1.5 | Boiling Point | 122ºC (1 torr) | |
| Molecular Formula | CH4O8P2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | Eaton's Reagent |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5 |
|---|---|
| Boiling Point | 122ºC (1 torr) |
| Molecular Formula | CH4O8P2S |
| Molecular Weight | 238.05000 |
| Flash Point | >230 °F |
| Exact Mass | 237.91000 |
| PSA | 208.54000 |
| LogP | 1.76360 |
| Appearance of Characters | Liquid | Clear |
| Index of Refraction | n20/D 1.435 |
| InChIKey | JHNLZOVBAQWGQU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.O=P(=O)OP(=O)=O |
| Water Solubility | Decomposes in water. |
| Hazard Codes | C:Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2922 8/PG 2 |
| WGK Germany | 1 |
| Packaging Group | III |
| Hazard Class | 8.0 |
| Eaton inverted exclamation markas Reagent |
| MFCD00070545 |
| Phosphorus Pentoxide - Methanesulfonic Acid |
| Phosphorus pentoxide |