2-Amino-4-nitrobenzotrifluoride structure
|
Common Name | 2-Amino-4-nitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 393-49-7 | Molecular Weight | 206.122 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 305.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H5F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.8±27.9 °C | |
| Name | 5-Nitro-2-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.9±42.0 °C at 760 mmHg |
| Molecular Formula | C7H5F3N2O2 |
| Molecular Weight | 206.122 |
| Flash Point | 138.8±27.9 °C |
| Exact Mass | 206.030319 |
| PSA | 71.84000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | LGHXDTHJGNCRKT-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])ccc1C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Nitro-2-(trifluoromethyl)aniline |
| 2-Trifluoromethyl-5-nitroaniline |
| Benzenamine, 5-nitro-2-(trifluoromethyl)- |
| 2-Amino-4-nitrobenzotrifluoride |
| PC5159 |