Diethyl (4-chlorobenzyl)phosphonate
Modify Date: 2025-08-20 16:51:16
Diethyl (4-chlorobenzyl)phosphonate structure
|
Common Name | Diethyl (4-chlorobenzyl)phosphonate | ||
|---|---|---|---|---|
| CAS Number | 39225-17-7 | Molecular Weight | 262.670 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 352.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H16ClO3P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 241.8±30.8 °C | |
| Name | diethyl 4-chlorobenzylphosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.4±25.0 °C at 760 mmHg |
| Molecular Formula | C11H16ClO3P |
| Molecular Weight | 262.670 |
| Flash Point | 241.8±30.8 °C |
| Exact Mass | 262.052551 |
| PSA | 45.34000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.501 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
![Benzenesulfonic acid,4-methyl-, 2-[(4-chlorophenyl)methylene]hydrazide structure](https://image.chemsrc.com/caspic/400/19350-69-7.png)
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (4-Chlorobenzyl)phosphonic Acid Diethyl Ester |
| Diethyl (4-chlorobenzyl)phosphonate |
| p-(Chlorobenzyl)phosphonic acid diethyl ester |
| EINECS 254-365-8 |
| Phosphonic acid, P-[(4-chlorophenyl)methyl]-, diethyl ester |
| Phosphonic acid, [(4-chlorophenyl)methyl]-, diethyl ester |
| Diethyl 4-chlorobenzylphosphonate |
| 1-chloro-4-(diethoxyphosphorylmethyl)benzene |
| MFCD00051568 |