8-Nitro-1,2,3,4-tetrahydro-quinoline structure
|
Common Name | 8-Nitro-1,2,3,4-tetrahydro-quinoline | ||
|---|---|---|---|---|
| CAS Number | 39217-93-1 | Molecular Weight | 178.18800 | |
| Density | 1.236±0.06 g/cm3(Predicted) | Boiling Point | 326.6±31.0 °C(Predicted) | |
| Molecular Formula | C9H10N2O2 | Melting Point | 82-84 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Nitro-1,2,3,4-tetrahydroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 326.6±31.0 °C(Predicted) |
| Melting Point | 82-84 °C |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.18800 |
| Exact Mass | 178.07400 |
| PSA | 57.85000 |
| LogP | 2.61410 |
| InChIKey | SKMXDVKIYCUVMM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c1NCCC2 |
| Storage condition | 2-8°C |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933499090 |
|
~%
8-Nitro-1,2,3,4... CAS#:39217-93-1 |
| Literature: Cordeiro, Alessandra; Shaw, Julian; O'Brien, John; Blanco, Fernando; Rozas, Isabel European Journal of Organic Chemistry, 2011 , # 8 p. 1504 - 1513 |
|
~%
8-Nitro-1,2,3,4... CAS#:39217-93-1 |
| Literature: Cordeiro, Alessandra; Shaw, Julian; O'Brien, John; Blanco, Fernando; Rozas, Isabel European Journal of Organic Chemistry, 2011 , # 8 p. 1504 - 1513 |
|
~%
8-Nitro-1,2,3,4... CAS#:39217-93-1 |
| Literature: Stoermer Chemische Berichte, 1898 , vol. 31, p. 2540 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-nitro-1,2,3,4-tetrahydro-quinoline |
| 8-Nitro-1,2,3,4-tetrahydro-chinolin |
| QC-8592 |
| 8-Nitrotetrahydrochinolin |