2-[4-(Dimethylamino)styryl]-1-methylquinolinium iodide structure
|
Common Name | 2-[4-(Dimethylamino)styryl]-1-methylquinolinium iodide | ||
|---|---|---|---|---|
| CAS Number | 3915-61-5 | Molecular Weight | 416.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21IN2 | Melting Point | 261ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 1-methyl-2-p-dimethylamino-styryl-quinolinium-iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 261ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C20H21IN2 |
| Molecular Weight | 416.29900 |
| Exact Mass | 416.07500 |
| PSA | 7.12000 |
| LogP | 0.90470 |
| Index of Refraction | 1.687 |
| InChIKey | VGLNXCCOYCGRLG-UHFFFAOYSA-M |
| SMILES | CN(C)c1ccc(C=Cc2ccc3ccccc3[n+]2C)cc1.[I-] |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H319-H335-H360 |
| Precautionary Statements | P201-P261-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R61 |
| Safety Phrases | 53-26-36/37/39-45 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[4-(dimethylamino)styryl]-1-methylquinolinium iodide |
| 2-(4-DIMETHYLAMINOSTYRYL)-1-METHYL |
| MFCD00031815 |
| 2-((E)-2-[4-(dimethylamino)phenyl]vinyl)-1-methylquinolinium iodide |
| (E)-2-(4-(dimethylamino)styryl)-1-methylquinolinium iodide |