4-[(3-chloro-2-hydroxypropyl)amino]benzoic acid structure
|
Common Name | 4-[(3-chloro-2-hydroxypropyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 39083-58-4 | Molecular Weight | 229.66000 | |
| Density | 1.402g/cm3 | Boiling Point | 471.4ºC at 760 mmHg | |
| Molecular Formula | C10H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.9ºC | |
| Name | 4-[(3-chloro-2-hydroxypropyl)amino]benzoic acid |
|---|
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 471.4ºC at 760 mmHg |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66000 |
| Flash Point | 238.9ºC |
| Exact Mass | 229.05100 |
| PSA | 69.56000 |
| LogP | 1.46940 |
| Index of Refraction | 1.632 |
| InChIKey | KWNZZVPNMSOJGU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NCC(O)CCl)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |