RMI 81,582 structure
|
Common Name | RMI 81,582 | ||
|---|---|---|---|---|
| CAS Number | 39051-50-8 | Molecular Weight | 310.82100 | |
| Density | 1.12g/cm3 | Boiling Point | 451.3ºC at 760 mmHg | |
| Molecular Formula | C19H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | (3E)-3-(2-chlorobenzo[c][1]benzazepin-11-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 451.3ºC at 760 mmHg |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.82100 |
| Flash Point | 226.8ºC |
| Exact Mass | 310.12400 |
| PSA | 15.60000 |
| LogP | 4.22300 |
| Index of Refraction | 1.594 |
| InChIKey | KGRYJYZBJQLPFW-CAOOACKPSA-N |
| SMILES | CN(C)CCC=C1c2ccccc2C=Nc2ccc(Cl)cc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-11-(3-dimethylaminopropylidene)morphanthridine |
| 3-(2-chloro-11h-dibenzo[b,e]azepin-11-ylidene)-n,n-dimethylpropan-1-amine |
| Rmi 81,582 |
| EX-11-582A |