1H-Purine-1-pentanoic acid, 2,3,6,7-tetrahydro-3,7-dimethyl-2,6-dioxo- structure
|
Common Name | 1H-Purine-1-pentanoic acid, 2,3,6,7-tetrahydro-3,7-dimethyl-2,6-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 38975-44-9 | Molecular Weight | 280.28000 | |
| Density | 1.44g/cm3 | Boiling Point | 571.9ºC at 760 mmHg | |
| Molecular Formula | C12H16N4O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 299.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 571.9ºC at 760 mmHg |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28000 |
| Flash Point | 299.7ºC |
| Exact Mass | 280.11700 |
| PSA | 99.12000 |
| Index of Refraction | 1.652 |
| InChIKey | JDMFPLGXRUJOTC-UHFFFAOYSA-N |
| SMILES | Cn1cnc2c1c(=O)n(CCCCC(=O)O)c(=O)n2C |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-dimethyl-1-(4-carboxybutyl)xanthine |
| 1H-Purine-1-pentanoic acid,2,3,6,7-tetrahydro-3,7-dimethyl-2,6-dioxo |
| 1-(4'-Carboxybutyl)-3,7-dimethylxanthine |
| pentoxifylline |
| CB-Dmx |
| 3,7-dimethyl-1-(5-oxohexyl)-3,7-dihydro-purine-2,6-dione |
| 5-(3,7-dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-purin-1-yl)-pentanoic acid |
| 1-(4-Carboxybutyl)-3,7-dimethylxanthin |