1-Propanone,2,3-dibromo-3-(4-nitrophenyl)-1-phenyl- structure
|
Common Name | 1-Propanone,2,3-dibromo-3-(4-nitrophenyl)-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 38895-96-4 | Molecular Weight | 413.06100 | |
| Density | 1.739g/cm3 | Boiling Point | 490.1ºC at 760mmHg | |
| Molecular Formula | C15H11Br2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dibromo-3-(4-nitrophenyl)-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.739g/cm3 |
|---|---|
| Boiling Point | 490.1ºC at 760mmHg |
| Molecular Formula | C15H11Br2NO3 |
| Molecular Weight | 413.06100 |
| Exact Mass | 410.91100 |
| PSA | 62.89000 |
| LogP | 5.20040 |
| Index of Refraction | 1.657 |
| InChIKey | RECMEXFQKOOMMK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Br)C(Br)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| p-nitrochalcone dibromide |
| p-nitrodibenzalacetophenone dibromide |
| 2,3-Dibromo-3-(4-nitrophenyl)propiophenone |
| 2,3-dibromo-3-(4-nitro-phenyl)-1-phenyl-propan-1-one |
| meso-p-nitrobenzalacetophenone dibromide |
| 1-Phenyl-3-(p-nitrophenyl)-2,3-dibromopropan-1-one |
| 3-(p-nitrophenyl)-1-phenyl-2,3-dibromopropenone |
| 4-Nitro-chalkondibromid |
| EINECS 254-182-3 |
| 1-Phenyl-2,3-dibromo-3-(4-nitrophenyl)propanone |
| 1-Propanone,2,3-dibromo-3-(4-nitrophenyl)-1-phenyl |