N-(2-hydroxy-4-nitro-phenyl)benzamide structure
|
Common Name | N-(2-hydroxy-4-nitro-phenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 38880-89-6 | Molecular Weight | 258.23000 | |
| Density | 1.446g/cm3 | Boiling Point | 351.8ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | N-(2-hydroxy-4-nitrophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760 mmHg |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23000 |
| Flash Point | 166.6ºC |
| Exact Mass | 258.06400 |
| PSA | 95.15000 |
| LogP | 3.14890 |
| Index of Refraction | 1.703 |
| InChIKey | UXCBYNIQABJIOQ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~91%
N-(2-hydroxy-4-... CAS#:38880-89-6 |
| Literature: Boger,D.L.; Coleman,R.S. Journal of the American Chemical Society, 1988 , vol. 110, p. 4796 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-2-benzamino-phenol |
| benzoic acid-(2-hydroxy-4-nitro-anilide) |
| Benzoesaeure-(2-hydroxy-4-nitro-anilid) |
| 5-Nitro-2-benzamidophenol |