(2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) acetate structure
|
Common Name | (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 38865-66-6 | Molecular Weight | 194.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14O3 |
|---|---|
| Molecular Weight | 194.22700 |
| Exact Mass | 194.09400 |
| PSA | 43.37000 |
| LogP | 1.78350 |
| InChIKey | MDFPPPIHFJPKRF-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C)C(OC(C)=O)CC1=O |
|
~85%
(2-methyl-4-oxo... CAS#:38865-66-6 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4535182 A1, 1985 ; |
|
~90%
(2-methyl-4-oxo... CAS#:38865-66-6 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4535182 A1, 1985 ; |
|
~24%
(2-methyl-4-oxo... CAS#:38865-66-6 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4535182 A1, 1985 ; |
|
~%
(2-methyl-4-oxo... CAS#:38865-66-6 |
| Literature: LaForge et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 2392 |
|
~%
(2-methyl-4-oxo... CAS#:38865-66-6 |
| Literature: Bullivant,M.J.; Pattenden,G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 249 - 256 |
| 4-Acetoxy-2-allyl-3-methyl-cyclopent-2-enon |
| 4-acetoxy-2-allyl-3-methyl-cyclopent-2-enone |
| (1S)-acetoxy-2-methyl-3-allyl-4-oxo-cyclopent-2-ene |
| 2-Cyclopenten-1-one,4-(acetyloxy)-3-methyl-2-(2-propenyl) |
| 4-acetoxy-2-allyl-3-methyl-2-cyclopentenone |
| (RS)-allethrolone acetate |