tert-Butyl 4-(3-aminophenyl)piperidine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(3-aminophenyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 387827-19-2 | Molecular Weight | 276.374 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 413.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7±28.7 °C | |
| Name | tert-butyl 4-(3-aminophenyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 413.2±45.0 °C at 760 mmHg |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.374 |
| Flash Point | 203.7±28.7 °C |
| Exact Mass | 276.183777 |
| PSA | 55.56000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | INZSWUJHGMIAJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc(N)c2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~84%
tert-Butyl 4-(3... CAS#:387827-19-2 |
| Literature: US2004/38855 A1, ; |
|
~86%
tert-Butyl 4-(3... CAS#:387827-19-2 |
| Literature: WO2006/10446 A2, ; Page/Page column 37 ; WO 2006/010446 A2 |
|
~86%
tert-Butyl 4-(3... CAS#:387827-19-2 |
| Literature: US2003/69261 A1, ; US 20030069261 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 4-(3-aminophenyl)-1-piperidinecarboxylate |
| 1-Piperidinecarboxylic acid, 4-(3-aminophenyl)-, 1,1-dimethylethyl ester |
| 4-(3-Amino-phenyl)-piperidine-1-carboxylic acid tert-Butyl ester |