1,3-dihydroxyxanthone structure
|
Common Name | 1,3-dihydroxyxanthone | ||
|---|---|---|---|---|
| CAS Number | 3875-68-1 | Molecular Weight | 228.20000 | |
| Density | 1.516g/cm3 | Boiling Point | 491.5ºC at 760mmHg | |
| Molecular Formula | C13H8O4 | Melting Point | 259 °C | |
| MSDS | N/A | Flash Point | 199.1ºC | |
| Name | 1,3-dihydroxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 491.5ºC at 760mmHg |
| Melting Point | 259 °C |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20000 |
| Flash Point | 199.1ºC |
| Exact Mass | 228.04200 |
| PSA | 70.67000 |
| LogP | 2.35740 |
| Index of Refraction | 1.717 |
| InChIKey | GTHOERCJZSJGHB-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2oc2cc(O)cc(O)c12 |
| HS Code | 2932999099 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9H-Xanthen-9-one,1,3-dihydroxy |
| 1,3-dihydroxy-xanthene-9-one |
| 1,3-dihydroxyxanthenone |
| 1,3-dihydroxy-9H-xanthen-9-one |
| 1,3-dihydroxy-xanthen-9-one |
| 3-dihydroxyxanthone |
| 1,3-dihydroxy-9H-xanthone |
| 1,3-Dihydroxyxanthone |