4,6-dimethoxy-2-(piperazin-1-ylmethyl)pyrimidine structure
|
Common Name | 4,6-dimethoxy-2-(piperazin-1-ylmethyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 387350-76-7 | Molecular Weight | 238.28600 | |
| Density | 1.141g/cm3 | Boiling Point | 264.7ºC at 760 mmHg | |
| Molecular Formula | C11H18N4O2 | Melting Point | 165-168ºC | |
| MSDS | USA | Flash Point | 113.9ºC | |
| Name | 4,6-dimethoxy-2-(piperazin-1-ylmethyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 264.7ºC at 760 mmHg |
| Melting Point | 165-168ºC |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.28600 |
| Flash Point | 113.9ºC |
| Exact Mass | 238.14300 |
| PSA | 59.51000 |
| LogP | 0.16570 |
| Index of Refraction | 1.593 |
| InChIKey | RZNQZUBONDNTBD-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)nc(CN2CCNCC2)n1 |
| Risk Phrases | 20/21/22-36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms522h12 |