5-(3,4-dichlorophenoxy)-2-nitrobenzonitrile structure
|
Common Name | 5-(3,4-dichlorophenoxy)-2-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 38710-80-4 | Molecular Weight | 309.10400 | |
| Density | 1.54g/cm3 | Boiling Point | 440.2ºC at 760 mmHg | |
| Molecular Formula | C13H6Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220ºC | |
| Name | 5-(3,4-dichlorophenoxy)-2-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 440.2ºC at 760 mmHg |
| Molecular Formula | C13H6Cl2N2O3 |
| Molecular Weight | 309.10400 |
| Flash Point | 220ºC |
| Exact Mass | 307.97600 |
| PSA | 78.84000 |
| LogP | 5.08878 |
| Index of Refraction | 1.655 |
| InChIKey | MWNWLTXLUKDENH-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(Oc2ccc(Cl)c(Cl)c2)ccc1[N+](=O)[O-] |
| HS Code | 2926909090 |
|---|
|
~%
5-(3,4-dichloro... CAS#:38710-80-4 |
| Literature: Elslager,E.F. et al. Journal of Heterocyclic Chemistry, 1972 , vol. 9, p. 759 - 773 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzonitrile,5-(3,4-dichlorophenoxy)-2-nitro |