Groenlandicine
Modify Date: 2025-08-21 16:36:37
Groenlandicine structure
|
Common Name | Groenlandicine | ||
|---|---|---|---|---|
| CAS Number | 38691-95-1 | Molecular Weight | 321.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16NO4+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GroenlandicineGroenlandicine is a protoberberine alkaloid isolated from Coptidis Rhizoma. Groenlandicine exhibits moderate inhibitory effect with IC50 value of 154.2 μM for human recombinant aldose reductase (HRAR)[1]. Groenlandicine selectively induces topoisomerase I-mediated DNA cleavage[2]. |
| Name | Dehydrocheilanthifoline |
|---|---|
| Synonym | More Synonyms |
| Description | Groenlandicine is a protoberberine alkaloid isolated from Coptidis Rhizoma. Groenlandicine exhibits moderate inhibitory effect with IC50 value of 154.2 μM for human recombinant aldose reductase (HRAR)[1]. Groenlandicine selectively induces topoisomerase I-mediated DNA cleavage[2]. |
|---|---|
| Related Catalog | |
| Target |
Topoisomerase I |
| References |
| Molecular Formula | C19H16NO4+ |
|---|---|
| Molecular Weight | 321.32700 |
| Exact Mass | 321.10000 |
| PSA | 48.64000 |
| LogP | 1.44980 |
| InChIKey | PGIOBGCIEGZHJH-UHFFFAOYSA-O |
| SMILES | COc1cc2c(cc1O)CC[n+]1cc3c4c(ccc3cc1-2)OCO4 |
| Storage condition | 2-8℃ |
| Benzo(a)-1,3-benzodioxolo(4,5-g)quinolizinium,11,12-dihydro-9-hydroxy-8-methoxy |
| Tetradehydrocheilanthiofolinium |
| Groenlandicine |
| Tetradehydrocheilanthifoline |