2-ethoxy-4-formylphenyl benzoate
Modify Date: 2025-09-17 18:23:46
2-ethoxy-4-formylphenyl benzoate structure
|
Common Name | 2-ethoxy-4-formylphenyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 385379-18-0 | Molecular Weight | 270.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethoxy-4-formylphenyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O4 |
|---|---|
| Molecular Weight | 270.28000 |
| Exact Mass | 270.08900 |
| PSA | 52.60000 |
| LogP | 3.11700 |
| InChIKey | MYURJQJYHBBLDS-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C=O)ccc1OC(=O)c1ccccc1 |
| HS Code | 2916310090 |
|---|
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-formyl-2-ethoxyphenyl benzoate |