2-Ethoxy-4-formylphenyl cyclopropanecarboxylate structure
|
Common Name | 2-Ethoxy-4-formylphenyl cyclopropanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 312525-45-4 | Molecular Weight | 234.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Ethoxy-4-formylphenyl cyclopropanecarboxylate |
|---|
| Molecular Formula | C13H14O4 |
|---|---|
| Molecular Weight | 234.24800 |
| Exact Mass | 234.08900 |
| PSA | 52.60000 |
| LogP | 2.21320 |
| InChIKey | CYABNFVKGZBCEW-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C=O)ccc1OC(=O)C1CC1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |