2-(2-morpholin-4-ylethylamino)naphthalene-1,4-dione structure
|
Common Name | 2-(2-morpholin-4-ylethylamino)naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 38528-37-9 | Molecular Weight | 286.32600 | |
| Density | 1.28g/cm3 | Boiling Point | 470.7ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.5ºC | |
| Name | 2-(2-morpholin-4-ylethylamino)naphthalene-1,4-dione |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 470.7ºC at 760 mmHg |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.32600 |
| Flash Point | 238.5ºC |
| Exact Mass | 286.13200 |
| PSA | 58.64000 |
| LogP | 1.20010 |
| Index of Refraction | 1.616 |
| InChIKey | OJGSHVZSMUWHEU-UHFFFAOYSA-N |
| SMILES | O=C1C=C(NCCN2CCOCC2)C(=O)c2ccccc21 |
|
~%
2-(2-morpholin-... CAS#:38528-37-9 |
| Literature: Porter; Skelton; Bowman; Folkers Journal of medicinal chemistry, 1972 , vol. 15, # 5 p. 504 - 506 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |