4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine
Modify Date: 2025-09-27 04:54:58
4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine structure
|
Common Name | 4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 38514-71-5 | Molecular Weight | 211.19800 | |
| Density | 1.572g/cm3 | Boiling Point | 428.2ºC at 760 mmHg | |
| Molecular Formula | C7H5N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | 4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.572g/cm3 |
|---|---|
| Boiling Point | 428.2ºC at 760 mmHg |
| Molecular Formula | C7H5N3O3S |
| Molecular Weight | 211.19800 |
| Flash Point | 212.8ºC |
| Exact Mass | 211.00500 |
| PSA | 126.84000 |
| LogP | 2.34680 |
| Index of Refraction | 1.673 |
| InChIKey | ZAVLMIGIVYJYMU-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc([N+](=O)[O-])o2)cs1 |
| HS Code | 2934100090 |
|---|
|
~%
4-(5-nitrofuran... CAS#:38514-71-5 |
| Literature: Sherman,W.R.; Dickson,D.E. Journal of Organic Chemistry, 1962 , vol. 27, p. 1351 - 1355 |
|
~%
4-(5-nitrofuran... CAS#:38514-71-5 |
| Literature: Saldabol,N.O. et al. J. Gen. Chem. USSR (Engl. Transl.), 1964 , vol. 34, # 5 p. 1598 - 1601,1608 - 1610 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Amino-4-(5-nitro-2-furyl)-thiazol |
| 4-(5-nitro-furan-2-yl)-thiazol-2-ylamine |
| ANFT |
| 2-Amino-4-<5-nitro-furyl-(2)>-thiazol |
| THIAZOLE,2-AMINO-4-(5-NITRO-2-FURYL) |
| 4-(5-Nitro-2-furanyl)-2-thiazolamine |
| 2-amino-4-(5-nitro-2-furyl)thiazole |
| 2-Amino-4-<5-nitro-fur-2-yl>-thiazol |
| 2-Thiazolamine,4-(5-nitro-2-furanyl) |