N-(5-chloro-2-methoxyphenyl)-2-[[5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide structure
|
Common Name | N-(5-chloro-2-methoxyphenyl)-2-[[5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 3845-30-5 | Molecular Weight | 527.06100 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H23ClN6O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-chloro-2-methoxyphenyl)-2-[[5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C24H23ClN6O2S2 |
| Molecular Weight | 527.06100 |
| Exact Mass | 526.10100 |
| PSA | 148.91000 |
| LogP | 6.00870 |
| Index of Refraction | 1.687 |
| InChIKey | WFVYKHITFMTVMO-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nnc(CSc2nc(C)cc(C)n2)n1-c1ccccc1 |
|
~%
N-(5-chloro-2-m... CAS#:3845-30-5 |
| Literature: Misra,A.K.; Lal,J.B. Indian Journal of Chemistry, 1965 , vol. 3, p. 322 - 323 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |