Phosphatidylinositols, soya, sodium salts structure
|
Common Name | Phosphatidylinositols, soya, sodium salts | ||
|---|---|---|---|---|
| CAS Number | 383907-36-6 | Molecular Weight | 857.03500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H78NaO13P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Phosphatidylinositols, soya, sodium saltsPhosphatidylinositols, soya, sodium salts is a mixture of phosphatidylinositols. Phosphoinositides are lipids involved in the vesicular transport of proteins and lipids between the different compartments of eukaryotic cells. They act by recruiting and/or activating effector proteins and thus are involved in regulating various cellular functions, such as vesicular budding, membrane fusion and cytoskeleton dynamics[1]. |
| Name | sodium,[(2R)-3-hexadecanoyloxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] [(5R)-2,3,4,5,6-pentahydroxycyclohexyl] phosphate |
|---|
| Description | Phosphatidylinositols, soya, sodium salts is a mixture of phosphatidylinositols. Phosphoinositides are lipids involved in the vesicular transport of proteins and lipids between the different compartments of eukaryotic cells. They act by recruiting and/or activating effector proteins and thus are involved in regulating various cellular functions, such as vesicular budding, membrane fusion and cytoskeleton dynamics[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Phosphoinositides are the major actors in membrane trafficking and lipid signaling pathways[1]. |
| References |
| Molecular Formula | C43H78NaO13P |
|---|---|
| Molecular Weight | 857.03500 |
| Exact Mass | 856.50800 |
| PSA | 222.15000 |
| LogP | 8.49470 |
| InChIKey | NTGSBERWOLXQBK-OXCFANCGSA-M |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCCCCCC=CCC=CCCCCC.[Na+] |
| Storage condition | -20°C |
| RIDADR | NONH for all modes of transport |
|---|