1-(4-Fluorophenyl)-2-phenyl-1,2-ethanedione
Modify Date: 2025-08-24 22:46:00
1-(4-Fluorophenyl)-2-phenyl-1,2-ethanedione structure
|
Common Name | 1-(4-Fluorophenyl)-2-phenyl-1,2-ethanedione | ||
|---|---|---|---|---|
| CAS Number | 3834-66-0 | Molecular Weight | 228.219 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 358.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H9FO2 | Melting Point | 64°C | |
| MSDS | N/A | Flash Point | 137.3±17.3 °C | |
| Name | Ethanedione, (4-fluorophenyl)phenyl- |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 358.9±25.0 °C at 760 mmHg |
| Melting Point | 64°C |
| Molecular Formula | C14H9FO2 |
| Molecular Weight | 228.219 |
| Flash Point | 137.3±17.3 °C |
| Exact Mass | 228.058655 |
| PSA | 34.14000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | JKQPFVOJZNRINB-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccc(F)cc1)c1ccccc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914700090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:70028-83-0| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Fluorobenzil |
| 1,2-Ethanedione, 1-(4-fluorophenyl)-2-phenyl- |
| 1-(4-Fluorophenyl)-2-phenyl-1,2-ethanedione |