2-Bromo-1-[4-(trifluoromethyl)phenyl]ethan-1-one structure
|
Common Name | 2-Bromo-1-[4-(trifluoromethyl)phenyl]ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 383-53-9 | Molecular Weight | 267.043 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 264.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H6BrF3O | Melting Point | 45-46ºC | |
| MSDS | Chinese USA | Flash Point | 113.6±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(Trifluoromethyl)phenacyl bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.2±40.0 °C at 760 mmHg |
| Melting Point | 45-46ºC |
| Molecular Formula | C9H6BrF3O |
| Molecular Weight | 267.043 |
| Flash Point | 113.6±27.3 °C |
| Exact Mass | 265.955414 |
| PSA | 17.07000 |
| LogP | 3.16 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | HEMROKPXTCOASZ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(C(F)(F)F)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 1759 |
| HS Code | 2914700090 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-(TrifluoroMethyl)phenacyl BroMide |
| MFCD00126489 |
| 2-Bromo-4′-(trifluoromethyl)acetophenone |
| Ethanone, 2-bromo-1-[4-(trifluoromethyl)phenyl]- |
| 2-bromo-1-[4-(trifluoromethyl)phenyl]-1-ethanone |
| 2-Bromo-1-[4-(trifluoromethyl)phenyl]ethanone |
| 2-bromo-1-[4-(trifluoromethyl)phenyl]ethan-1-one |
| 2-Bromo-4'-(trifluoromethyl)acetophenone |
| 2-Bromo-4'-(trifluoromethyl)acetophenon |