N-[2-[benzoyl(methyl)amino]phenyl]benzamide
Modify Date: 2025-08-26 14:50:16
![N-[2-[benzoyl(methyl)amino]phenyl]benzamide Structure](https://image.chemsrc.com/caspic/100/38182-45-5.png)
N-[2-[benzoyl(methyl)amino]phenyl]benzamide structure
|
Common Name | N-[2-[benzoyl(methyl)amino]phenyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 38182-45-5 | Molecular Weight | 330.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-[benzoyl(methyl)amino]phenyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18N2O2 |
|---|---|
| Molecular Weight | 330.38000 |
| Exact Mass | 330.13700 |
| PSA | 52.90000 |
| LogP | 4.59950 |
| InChIKey | LUBMDZYBEUVDGQ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)c1ccccc1)c1ccccc1NC(=O)c1ccccc1 |
|
~%
N-[2-[benzoyl(m... CAS#:38182-45-5 |
| Literature: Cappel; Fernelius Journal of Organic Chemistry, 1940 , vol. 5, p. 40,44 |
|
~%
N-[2-[benzoyl(m... CAS#:38182-45-5 |
| Literature: Cappel; Fernelius Journal of Organic Chemistry, 1940 , vol. 5, p. 40,44 |
|
~%
N-[2-[benzoyl(m... CAS#:38182-45-5 |
| Literature: Cappel; Fernelius Journal of Organic Chemistry, 1940 , vol. 5, p. 40,44 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Methyl-N,N'-o-phenylen-bis-benzamid |
| N,N'-Dibenzoyl-N-methyl-o-phenylendiamin |
| N-methyl-N,N'-o-phenylene-bis-benzamide |
| Benzamide,N-[2-(benzoylamino)phenyl]-N-methyl |
| N-Methyl-N.N'-dibenzoyl-o-phenylendiamin |