1,3-Bis(dicyanomethylene)indan structure
|
Common Name | 1,3-Bis(dicyanomethylene)indan | ||
|---|---|---|---|---|
| CAS Number | 38172-19-9 | Molecular Weight | 242.23500 | |
| Density | 1.377g/cm3 | Boiling Point | 484.5ºC at 760 mmHg | |
| Molecular Formula | C15H6N4 | Melting Point | 250ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 243.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,3-Bis(dicyanomethylene)indan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 484.5ºC at 760 mmHg |
| Melting Point | 250ºC (dec.)(lit.) |
| Molecular Formula | C15H6N4 |
| Molecular Weight | 242.23500 |
| Flash Point | 243.6ºC |
| Exact Mass | 242.05900 |
| PSA | 95.16000 |
| LogP | 2.69182 |
| Index of Refraction | 1.661 |
| InChIKey | HBZYYOYCJQHAEL-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=C1CC(=C(C#N)C#N)c2ccccc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Gonzalez,M. et al.
Tetrahedron Lett. 40 , 8599, (1999)
|
| MFCD00142514 |
| 2-[3-(dicyanomethylidene)inden-1-ylidene]propanedinitrile |
| (Indan-1,3-diylidene)dimalononitrile |
| 1,3-Bis(dicyanoMethylidene)indan |