Rifamycin, 4-O-[2-oxo-2- (tripropylhydrazino)ethyl]- structure
|
Common Name | Rifamycin, 4-O-[2-oxo-2- (tripropylhydrazino)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 38123-25-0 | Molecular Weight | 896.07400 | |
| Density | 1.26g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C48H69N3O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Rifamycin B tripropylhydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Molecular Formula | C48H69N3O13 |
| Molecular Weight | 896.07400 |
| Exact Mass | 895.48300 |
| PSA | 213.86000 |
| LogP | 6.84090 |
| Index of Refraction | 1.6 |
| InChIKey | PPGOZIJHGOGHLF-CTZMIWHQSA-N |
| SMILES | CCCN(CCC)N(CCC)C(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
Rifamycin, 4-O-... CAS#:38123-25-0 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| rifamycin-B tripropylhydrazide |
| Rifamycin-B-tripropyl-hydrazid |