Acetic acid, ((1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-9-yl)oxy)-, 21-acetate, 2,2-diethyl structure
|
Common Name | Acetic acid, ((1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-9-yl)oxy)-, 21-acetate, 2,2-diethyl | ||
|---|---|---|---|---|
| CAS Number | 38123-23-8 | Molecular Weight | 868.02100 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C46H65N3O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Acetic acid, [[1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca[1,11,13]trienimino)naphtho[2,1-b]furan-9-yl]oxy]-, 21-acetate, 2,2-diethyl-1-propylhydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C46H65N3O13 |
| Molecular Weight | 868.02100 |
| Exact Mass | 867.45200 |
| PSA | 213.86000 |
| LogP | 6.06070 |
| Index of Refraction | 1.605 |
| InChIKey | OPFFQPAPHBUEBG-OWFDCOTPSA-N |
| SMILES | CCCN(C(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4)N(CC)CC |
|
~%
Acetic acid, ((... CAS#:38123-23-8 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| rifamycin-B N',N'-diethyl-N-propyl-hydrazide |
| Rifamycin-B-diaethyl-propyl-hydrazid |