Acetic acid, [[1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2, 4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca[1,11, 13]trienimino)naphtho[2,1-b]furan-9-yl]oxy]-, 21-acetate, 1,2, 2-tr structure
|
Common Name | Acetic acid, [[1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2, 4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca[1,11, 13]trienimino)naphtho[2,1-b]furan-9-yl]oxy]-, 21-acetate, 1,2, 2-tr | ||
|---|---|---|---|---|
| CAS Number | 38123-22-7 | Molecular Weight | 853.99400 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C45H63N3O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Acetic acid, [[1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca[1,11,13]trienimino)naphtho[2,1-b]furan-9-yl]oxy]-, 21-acetate, 1,2,2-triethylhydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C45H63N3O13 |
| Molecular Weight | 853.99400 |
| Exact Mass | 853.43600 |
| PSA | 213.86000 |
| LogP | 5.67060 |
| Index of Refraction | 1.608 |
| InChIKey | UZXNOLAAKYOPFA-FOIQVEDFSA-N |
| SMILES | CCN(CC)N(CC)C(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
Acetic acid, [[... CAS#:38123-22-7 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Rifamycin-B-triaethylhydrazid |
| Rifamycin-B-tert.-butylamid |
| rifamycin-B triethylhydrazide |
| rifamycin-B tert-butylamide |
| O4-(triethylhydrazinocarbonyl-methyl)-rifamycin |