5-(4-fluorophenyl)furan-2-carbonyl chloride structure
|
Common Name | 5-(4-fluorophenyl)furan-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 380889-69-0 | Molecular Weight | 224.61600 | |
| Density | 1.335g/cm3 | Boiling Point | 326.1ºC at 760 mmHg | |
| Molecular Formula | C11H6ClFO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151ºC | |
| Name | 5-(4-fluorophenyl)furan-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 326.1ºC at 760 mmHg |
| Molecular Formula | C11H6ClFO2 |
| Molecular Weight | 224.61600 |
| Flash Point | 151ºC |
| Exact Mass | 224.00400 |
| PSA | 30.21000 |
| LogP | 3.46470 |
| Index of Refraction | 1.547 |
| InChIKey | LAICLIOPDMJLFC-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(-c2ccc(F)cc2)o1 |
| RIDADR | UN3261 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2932190090 |
|
~88%
5-(4-fluorophen... CAS#:380889-69-0 |
| Literature: Russian Journal of Organic Chemistry, , vol. 45, # 4 p. 541 - 550 |
|
~%
5-(4-fluorophen... CAS#:380889-69-0 |
| Literature: Chemical Biology and Drug Design, , vol. 79, # 1 p. 121 - 127 |
|
~%
5-(4-fluorophen... CAS#:380889-69-0 |
| Literature: Chemical Biology and Drug Design, , vol. 79, # 1 p. 121 - 127 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD02258010 |