5-Nitrobenzene-1,2,3-tricarboxylic acid structure
|
Common Name | 5-Nitrobenzene-1,2,3-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3807-81-6 | Molecular Weight | 255.138 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 546.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C9H5NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.4±18.6 °C | |
| Name | 5-nitrobenzene-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.4±50.0 °C at 760 mmHg |
| Molecular Formula | C9H5NO8 |
| Molecular Weight | 255.138 |
| Flash Point | 240.4±18.6 °C |
| Exact Mass | 255.001511 |
| PSA | 157.72000 |
| LogP | 0.21 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | KIRNHRJGEAFKPM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc(C(=O)O)c1C(=O)O |
| Hazard Codes | Xi |
|---|
|
~%
5-Nitrobenzene-... CAS#:3807-81-6 |
| Literature: American Cyanamid Company Patent: US4245119 A1, 1981 ; |
|
~80%
5-Nitrobenzene-... CAS#:3807-81-6 |
| Literature: Capassso, Renato; Randazzo, Giacomino; Stipani, Italo; Zara, Vincenzo; Palmieri, Ferdinando Gazzetta Chimica Italiana, 1989 , vol. 119, # 8 p. 449 - 452 |
|
~%
5-Nitrobenzene-... CAS#:3807-81-6 |
| Literature: Capassso, Renato; Randazzo, Giacomino; Stipani, Italo; Zara, Vincenzo; Palmieri, Ferdinando Gazzetta Chimica Italiana, 1989 , vol. 119, # 8 p. 449 - 452 |
|
~%
5-Nitrobenzene-... CAS#:3807-81-6 |
| Literature: Baer,H.H.; Kienzle,F. Journal of Organic Chemistry, 1968 , vol. 33, # 5 p. 1823 - 1830 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| MFCD03839939 |
| 5-Nitro-benzol-1,2,3-tricarbonsaeure |
| 1-Nitrobenzene-3,4,5-tricarboxylic acid |
| 1,2,3-Benzenetricarboxylic acid, 5-nitro- |
| 5-nitro-1,2,3-benzenetricarboxylate |
| 5-Nitro-1,2,3-benzenetricarboxylic acid |
| 5-nitro-benzene-1,2,3-tricarboxylic acid |
| 5-nitrobenzene-1,2,3-tricarboxylic acid |