2,3,4,9-Tetrahydro-1H-carbazole-2-carboxylic acid structure
|
Common Name | 2,3,4,9-Tetrahydro-1H-carbazole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 37964-14-0 | Molecular Weight | 215.248 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 454.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.4±28.7 °C | |
| Name | 2,3,4,9-Tetrahydro-1H-carbazole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 454.1±45.0 °C at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.248 |
| Flash Point | 228.4±28.7 °C |
| Exact Mass | 215.094635 |
| PSA | 53.09000 |
| LogP | 2.61 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | VSIDDKKWZMIYEV-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCc2c([nH]c3ccccc23)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~63%
2,3,4,9-Tetrahy... CAS#:37964-14-0 |
| Literature: HUNTER-FLEMING LIMITED Patent: WO2006/82409 A2, 2006 ; Location in patent: Page/Page column 15 ; |
|
~%
2,3,4,9-Tetrahy... CAS#:37964-14-0 |
| Literature: Neurogen Corporation Patent: US5892041 A1, 1999 ; |
|
~%
2,3,4,9-Tetrahy... CAS#:37964-14-0 |
| Literature: Baeyer; Tutein Chemische Berichte, 1889 , vol. 22, p. 2183 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,3,4-tetrahydrocarbazole-2-carboxylic acid |
| 1H-Carbazole-2-carboxylic acid, 2,3,4,9-tetrahydro- |
| 2,3,4,9-Tetrahydro-1H-carbazole-2-carboxylic acid |
| 1,2,3,4-Tetrahydrocarbazol-2-carbonsaeure |