2,2,3,4,4,4-hexafluorobutanoic acid
Modify Date: 2025-09-30 22:49:46
2,2,3,4,4,4-hexafluorobutanoic acid structure
|
Common Name | 2,2,3,4,4,4-hexafluorobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 379-90-8 | Molecular Weight | 196.04800 | |
| Density | 1.602g/cm3 | Boiling Point | 130.9ºC at 760 mmHg | |
| Molecular Formula | C4H2F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33ºC | |
| Name | 2,2,3,4,4,4-hexafluorobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.602g/cm3 |
|---|---|
| Boiling Point | 130.9ºC at 760 mmHg |
| Molecular Formula | C4H2F6O2 |
| Molecular Weight | 196.04800 |
| Flash Point | 33ºC |
| Exact Mass | 195.99600 |
| PSA | 37.30000 |
| LogP | 1.60670 |
| Index of Refraction | 1.301 |
| InChIKey | AZLUIEGTKBIKSG-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
|
~%
2,2,3,4,4,4-hex... CAS#:379-90-8 |
| Literature: LaZerte; Koshar Journal of the American Chemical Society, 1955 , vol. 77, p. 910,914 |
|
~%
2,2,3,4,4,4-hex... CAS#:379-90-8 |
| Literature: Du Pont de Nemours and Co. Patent: US2802028 , 1956 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,2,3,3-TETRAMETHYLPIPERAZINE-1,4-DIOL |
| 2,2,3,4,4,4-hexafluorobutyric acid |
| (+-)-2,2,3,4,4,4-Hexafluor-buttersaeure |