2,2,3,3,4,4,4-Heptafluorobutyl methacrylate structure
|
Common Name | 2,2,3,3,4,4,4-Heptafluorobutyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 13695-31-3 | Molecular Weight | 268.129 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 148.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H7F7O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 43.3±22.2 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 2,2,3,3,4,4,4-Heptafluorobutyl Methacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 148.8±40.0 °C at 760 mmHg |
| Molecular Formula | C8H7F7O2 |
| Molecular Weight | 268.129 |
| Flash Point | 43.3±22.2 °C |
| Exact Mass | 268.033417 |
| PSA | 26.30000 |
| LogP | 3.96 |
| Vapour Pressure | 4.2±0.3 mmHg at 25°C |
| Index of Refraction | 1.341 |
| InChIKey | VIEHKBXCWMMOOU-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | Keep Cold |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H302-H312-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,F,Xi |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2916140000 |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| 1H,1H-HEPTAFLUOROBUTYL METHACRYLATE |
| MFCD00039251 |
| METHACRYLIC ACID, 2,2,3,3,4,4,4-HEPTAFLUOROBUTYL ESTER |
| 2,2,3,3,4,4,4-Heptafluorobutyl methacrylate |
| EINECS 237-217-7 |
| 2-Propenoic acid, 2-methyl-, 2,2,3,3,4,4,4-heptafluorobutyl ester |