(2-Bromophenoxy)triisopropylsilane structure
|
Common Name | (2-Bromophenoxy)triisopropylsilane | ||
|---|---|---|---|---|
| CAS Number | 378787-34-9 | Molecular Weight | 329.35 | |
| Density | 1.162 g/mL at 25 °C | Boiling Point | 320-328°C | |
| Molecular Formula | C15H25BrOSi | Melting Point | N/A | |
| MSDS | USA | Flash Point | >110℃ | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2-Bromophenoxy)triisopropylsilane |
|---|
| Density | 1.162 g/mL at 25 °C |
|---|---|
| Boiling Point | 320-328°C |
| Molecular Formula | C15H25BrOSi |
| Molecular Weight | 329.35 |
| Flash Point | >110℃ |
| Index of Refraction | n20/D1.525 |
| InChIKey | DRKVJKKIFDUDIL-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](Oc1ccccc1Br)(C(C)C)C(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |