4-amino-N-[2-(diethylamino)ethyl]-2-methoxybenzamide structure
|
Common Name | 4-amino-N-[2-(diethylamino)ethyl]-2-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 3761-48-6 | Molecular Weight | 265.35100 | |
| Density | 1.079g/cm3 | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C14H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 4-amino-N-[2-(diethylamino)ethyl]-2-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.079g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760 mmHg |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.35100 |
| Flash Point | 216.2ºC |
| Exact Mass | 265.17900 |
| PSA | 71.08000 |
| LogP | 2.50500 |
| Index of Refraction | 1.544 |
| InChIKey | AQOCQFLDHPSJLR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1ccc(N)cc1OC |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 223-177-8 |
| 4-Amino-2-methoxy-benzoesaeure-(2-diaethylamino-aethylamid) |
| 4-amino-2-methoxy-benzoic acid-(2-diethylamino-ethylamide) |
| 4-amino-N-(2-diethylaminoethyl)-2-methoxybenzamide |
| 2-Chloro-1-methyl-3-nitro-benzene |