N,N-bis(2-methylpropyl)octadec-9-enamide structure
|
Common Name | N,N-bis(2-methylpropyl)octadec-9-enamide | ||
|---|---|---|---|---|
| CAS Number | 37595-59-8 | Molecular Weight | 393.68900 | |
| Density | 0.862g/cm3 | Boiling Point | 490.2ºC at 760 mmHg | |
| Molecular Formula | C26H51NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6ºC | |
| Name | N,N-bis(2-methylpropyl)octadec-9-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.862g/cm3 |
|---|---|
| Boiling Point | 490.2ºC at 760 mmHg |
| Molecular Formula | C26H51NO |
| Molecular Weight | 393.68900 |
| Flash Point | 194.6ºC |
| Exact Mass | 393.39700 |
| PSA | 20.31000 |
| LogP | 8.16450 |
| Index of Refraction | 1.465 |
| InChIKey | CDGZMJQGBQRSFY-YPKPFQOOSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N(CC(C)C)CC(C)C |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-Diisobutyloleamide |