1-dimethoxyphosphoryldecan-2-one structure
|
Common Name | 1-dimethoxyphosphoryldecan-2-one | ||
|---|---|---|---|---|
| CAS Number | 37497-13-5 | Molecular Weight | 264.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H25O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-dimethoxyphosphoryldecan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H25O4P |
|---|---|
| Molecular Weight | 264.29800 |
| Exact Mass | 264.14900 |
| PSA | 62.41000 |
| LogP | 3.79200 |
| InChIKey | LWYUTMRIBOHSBQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)CP(=O)(OC)OC |
|
~%
1-dimethoxyphos... CAS#:37497-13-5 |
| Literature: Wenkert; Guo; Lavilla; Porter; Ramachandran; Sheu Journal of Organic Chemistry, 1990 , vol. 55, # 25 p. 6203 - 6214 |
|
~%
1-dimethoxyphos... CAS#:37497-13-5 |
| Literature: Vig, O P; Bari, S S; Sethi, Madhuresh K; Sattar, M A Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 6 p. 608 - 610 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dimethyl-2-oxodecylphosphonat |
| dimethyl 2-oxodecane-1-phosphonate |
| dimetyl 2-oxodecylphosphonate |
| Phosphonic acid,(2-oxodecyl)-,dimethyl ester |
| dimethyl 2-oxodecylophosphonate |
| 2-oxo-decyl-phosphonic acid dimethyl ester |
| dimethyl-2-oxodecanylphosphonate |
| dimethyl 2-oxo-decylphosphonate |