1,7-dihydroxy-6,8-dimethylphenoxazin-3-one
Modify Date: 2025-09-21 11:09:52
1,7-dihydroxy-6,8-dimethylphenoxazin-3-one structure
|
Common Name | 1,7-dihydroxy-6,8-dimethylphenoxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 37167-47-8 | Molecular Weight | 257.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,7-dihydroxy-6,8-dimethylphenoxazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11NO4 |
|---|---|
| Molecular Weight | 257.24100 |
| Exact Mass | 257.06900 |
| PSA | 83.56000 |
| LogP | 2.32080 |
| InChIKey | AYCDUKGAFOTMKK-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc3c(O)cc(=O)cc-3oc2c(C)c1O |
|
~%
1,7-dihydroxy-6... CAS#:37167-47-8 |
| Literature: Ruzicka,E. et al. Collection of Czechoslovak Chemical Communications, 1972 , vol. 37, p. 1905 - 1907 |
|
~%
1,7-dihydroxy-6... CAS#:37167-47-8 |
| Literature: Ruzicka,E. et al. Collection of Czechoslovak Chemical Communications, 1972 , vol. 37, p. 1905 - 1907 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3H-Phenoxazin-3-one,7,9-dihydroxy-2,4-dimethyl |
| 1,7-dihydroxy-6,8-dimethyl-phenoxazin-3-one |
| 2,4-Dimethyl-7,9-dihydroxy-phenoxazin-3-one |
| 7,9-dihydroxy-2,4-dimethyl-phenoxazin-3-one |