dl-camphor anhydride structure
|
Common Name | dl-camphor anhydride | ||
|---|---|---|---|---|
| CAS Number | 37082-52-3 | Molecular Weight | 293.23900 | |
| Density | 2.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H11N7O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dl-camphor anhydride |
|---|
| Density | 2.38g/cm3 |
|---|---|
| Molecular Formula | C10H11N7O4 |
| Molecular Weight | 293.23900 |
| Exact Mass | 293.08700 |
| PSA | 143.71000 |
| Index of Refraction | 2.102 |
| InChIKey | IZINBYPJBKCTOK-UHFFFAOYSA-N |
| SMILES | OCC1OC(n2cnc3c2ncn2nnnc32)C(O)C1O |
|
~70%
dl-camphor anhydride CAS#:37082-52-3 |
| Literature: Lakshman, Mahesh K.; Singh, Manish K.; Parrish, Damon; Balachandran, Raghavan; Day, Billy W. Journal of Organic Chemistry, 2010 , vol. 75, # 8 p. 2461 - 2473 |
|
~%
dl-camphor anhydride CAS#:37082-52-3 |
| Literature: Mathe, Christophe; Lioux, Thierry; Gosselin, Gilles Nucleosides, Nucleotides and Nucleic Acids, 2003 , vol. 22, # 5-8 p. 605 - 609 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |