5,5'-(1H-isoindole-1,3(2H)-diylidene)dibarbituric acid
Modify Date: 2025-09-05 16:04:02
5,5'-(1H-isoindole-1,3(2H)-diylidene)dibarbituric acid structure
|
Common Name | 5,5'-(1H-isoindole-1,3(2H)-diylidene)dibarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 36888-99-0 | Molecular Weight | 367.27300 | |
| Density | 1.696 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H9N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5,5'-(1H-isoindole-1,3(2H)-diylidene)dibarbituric acidPigment Yellow 139 is a biological dye and indicator[1]. |
| Name | Pigment Yellow 139 |
|---|---|
| Synonym | More Synonyms |
| Description | Pigment Yellow 139 is a biological dye and indicator[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.696 g/cm3 |
|---|---|
| Molecular Formula | C16H9N5O6 |
| Molecular Weight | 367.27300 |
| Exact Mass | 367.05500 |
| PSA | 166.33000 |
| Index of Refraction | 1.698 |
| InChIKey | VXQNQGCWKZPKET-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(=C2N=C(c3c(O)[nH]c(=O)[nH]c3=O)c3ccccc32)C(=O)N1 |
| EINECS 253-256-2 |
| Yellow L1820 |