1,4,3-Oxathiazine,5,6-dihydro-2-methoxy-6-phenyl-, 4,4-dioxide structure
|
Common Name | 1,4,3-Oxathiazine,5,6-dihydro-2-methoxy-6-phenyl-, 4,4-dioxide | ||
|---|---|---|---|---|
| CAS Number | 36743-47-2 | Molecular Weight | 241.26400 | |
| Density | 1.38g/cm3 | Boiling Point | 363.1ºC at 760mmHg | |
| Molecular Formula | C10H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.4ºC | |
| Name | 2-methoxy-6-phenyl-5,6-dihydro-1,4,3-oxathiazine 4,4-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 363.1ºC at 760mmHg |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.26400 |
| Flash Point | 173.4ºC |
| Exact Mass | 241.04100 |
| PSA | 73.34000 |
| LogP | 1.60650 |
| Index of Refraction | 1.593 |
| InChIKey | PTQMBYSYUYLZST-UHFFFAOYSA-N |
| SMILES | COC1=NS(=O)(=O)CC(c2ccccc2)O1 |
|
~%
1,4,3-Oxathiazi... CAS#:36743-47-2 |
| Literature: Burgess,E.M.; Williams,W.M. Journal of the American Chemical Society, 1972 , vol. 94, # 12 p. 4386 - 4387 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-Dihydro-2-phenyl-6-methoxy-1,4,5-oxathiazin-4,4-dioxid |