methyl 1,1-dioxo-3-phenyl-thiazetidine-2-carboxylate
Modify Date: 2025-09-19 05:46:58
methyl 1,1-dioxo-3-phenyl-thiazetidine-2-carboxylate structure
|
Common Name | methyl 1,1-dioxo-3-phenyl-thiazetidine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 36743-46-1 | Molecular Weight | 241.26400 | |
| Density | 1.415g/cm3 | Boiling Point | 376.2ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | methyl 1,1-dioxo-3-phenylthiazetidine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 376.2ºC at 760 mmHg |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.26400 |
| Flash Point | 181.3ºC |
| Exact Mass | 241.04100 |
| PSA | 72.06000 |
| LogP | 2.15820 |
| Index of Refraction | 1.593 |
| InChIKey | ZAUAYVCJDGYHLK-UHFFFAOYSA-N |
| SMILES | COC(=O)N1C(c2ccccc2)CS1(=O)=O |
|
~%
methyl 1,1-diox... CAS#:36743-46-1 |
| Literature: Burgess,E.M.; Williams,W.M. Journal of the American Chemical Society, 1972 , vol. 94, # 12 p. 4386 - 4387 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Carbomethoxy-3-phenyl-1,2-thiazetidin-1,1-dioxid |
| methyl 3-phenyl-1,2-thiazetidine-2-carboxylate 1,1-dioxide |