1,4-Dibromo-2-Fluoro-5-Nitrobenzene structure
|
Common Name | 1,4-Dibromo-2-Fluoro-5-Nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 366496-33-5 | Molecular Weight | 298.89200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2Br2FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-Dibromo-2-Fluoro-5-Nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H2Br2FNO2 |
|---|---|
| Molecular Weight | 298.89200 |
| Exact Mass | 296.84400 |
| PSA | 45.82000 |
| LogP | 3.78210 |
| InChIKey | WDFCYQDGGDTTCT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c(F)cc1Br |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2904909090 |
|
~78%
1,4-Dibromo-2-F... CAS#:366496-33-5 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2007/30366 A1, 2007 ; Location in patent: Page/Page column 121-122 ; |
|
~91%
1,4-Dibromo-2-F... CAS#:366496-33-5 |
| Literature: Chen; Konstantinov; Chittim; Joyce; Bols; Bunce Environmental Science and Technology, 2001 , vol. 35, # 18 p. 3749 - 3756 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-dibromo-2-fluoro-5-nitrobenzene |