methyl 4-(3-nitrophenyl)sulfonyloxybenzoate
Modify Date: 2025-09-23 16:08:37
methyl 4-(3-nitrophenyl)sulfonyloxybenzoate structure
|
Common Name | methyl 4-(3-nitrophenyl)sulfonyloxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 36601-42-0 | Molecular Weight | 337.30500 | |
| Density | 1.448g/cm3 | Boiling Point | 515.8ºC at 760 mmHg | |
| Molecular Formula | C14H11NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.8ºC | |
| Name | methyl 4-(3-nitrophenyl)sulfonyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 515.8ºC at 760 mmHg |
| Molecular Formula | C14H11NO7S |
| Molecular Weight | 337.30500 |
| Flash Point | 265.8ºC |
| Exact Mass | 337.02600 |
| PSA | 123.87000 |
| LogP | 3.75310 |
| Index of Refraction | 1.595 |
| InChIKey | LWUZHUCTXNUEGY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
methyl 4-(3-nit... CAS#:36601-42-0 |
| Literature: Dannley,R.L.; Knipple,W.R. Journal of Organic Chemistry, 1973 , vol. 38, # 1 p. 6 - 11 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| methyl 4-{[(3-nitrophenyl)sulfonyl]oxy}benzoate |